Products 1360936-21-5
CAS 1360936-21-5 is the registry number for 6-Fluoro-4-(trifluoromethyl)-1h-benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-fluoro-4-(trifluoromethyl)-1H-benzimidazole (CAS 1360936-21-5) is a chemical compound with the molecular formula C8H4F4N2 and a molecular weight of 204.12 g/mol. IUPAC name: 6-fluoro-4-(trifluoromethyl)-1H-benzimidazole. InChIKey: YYYYQHNNTLLAEL-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2 |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | 6-fluoro-4-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | YYYYQHNNTLLAEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(F)(F)F)N=CN2)F |
Computed by PubChem (NCBI)