CAS 1095188-12-7 is the registry number for 4-Amino-3-fluoro-2-(trifluoromethyl)benzonitrile, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile (CAS 1095188-12-7) is a chemical compound with the molecular formula C8H4F4N2 and a molecular weight of 204.12 g/mol. IUPAC name: 4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile. InChIKey: OWIGNTFYLJUGDK-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2 |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | 4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile |
| InChIKey | OWIGNTFYLJUGDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)C(F)(F)F)F)N |
Computed by PubChem (NCBI)