CAS 220057-70-5 appears in our catalog under these names: 4,5,6,7-Tetrafluoro-3-methyl-1h-indazole, 95%, 4,5,6,7–Tetrafluoro–3–methyl–1H–indazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
4,5,6,7-tetrafluoro-3-methyl-2H-indazole (CAS 220057-70-5) is a chemical compound with the molecular formula C8H4F4N2 and a molecular weight of 204.12 g/mol. IUPAC name: 4,5,6,7-tetrafluoro-3-methyl-2H-indazole. InChIKey: MEHLPQAUVAMMPE-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2 |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | 4,5,6,7-tetrafluoro-3-methyl-2H-indazole |
| InChIKey | MEHLPQAUVAMMPE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C(=C(C2=NN1)F)F)F)F |
Computed by PubChem (NCBI)