cas: 1823548-94-2 — see every product listed under this CAS number, including other names
4-Amino-4-benzyltetrahydro-2H-thiopyran 1,1-dioxide hydrochloride, 98% (CAS 1823548-94-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2254536-1g |
| cas | 1823548-94-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 15303.40 Pln | |
| AmBeed | 250mg | 6163.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-benzyl-1,1-dioxothian-4-amine;hydrochloride (CAS 1823548-94-2) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. IUPAC name: 4-benzyl-1,1-dioxothian-4-amine;hydrochloride. InChIKey: LNLURSSZFDDBCI-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 275.80 g/mol |
| IUPAC name | 4-benzyl-1,1-dioxothian-4-amine;hydrochloride |
| InChIKey | LNLURSSZFDDBCI-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)