Products 1246816-31-8
CAS 1246816-31-8 appears in our catalog under these names: Dimethenamid-d3, >95% (HPLC), Dimethenamid–d3, Dimethenamid-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[1-(trideuteriomethoxy)propan-2-yl]acetamide (CAS 1246816-31-8) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 278.81 g/mol. IUPAC name: 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[1-(trideuteriomethoxy)propan-2-yl]acetamide. InChIKey: JLYFCTQDENRSOL-GKOSEXJESA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 278.81 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[1-(trideuteriomethoxy)propan-2-yl]acetamide |
| InChIKey | JLYFCTQDENRSOL-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OCC(C)N(C1=C(SC=C1C)C)C(=O)CCl |
Computed by PubChem (NCBI)