4-Amino-4-phenylbutanoic acid, 95%
cas: 1011-60-5 — see every product listed under this CAS number, including other names
4-Amino-4-phenylbutanoic acid, 95% (CAS 1011-60-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A347101-250mg |
| cas | 1011-60-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1443.94 Pln | |
| Ambeed | 5g | 5571.31 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1528.40 Pln | |
| Chemat | 5g | 5925.20 Pln | |
| BLDpharm | 100mg | 397.66 Pln | |
| BLDpharm | 250mg | 625.36 Pln | |
| BLDpharm | 1g | 1552.81 Pln | |
| BLDpharm | 5g | 6001.24 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-amino-4-phenylbutanoic acid (CAS 1011-60-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-amino-4-phenylbutanoic acid. InChIKey: QCHLDIVWWGHNQB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-amino-4-phenylbutanoic acid |
| InChIKey | QCHLDIVWWGHNQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
4-amino-4-phenylbutanoic acid, 4-Amino-4-phenyl-butyric acid, 4-amino-4-phenyl-butanoic acid, Benzenebutanoic acid, gamma-amino-, (R)-4-Amino-4-phenyl-butyric acid, gamma-Phenyl GABA, 4-Amino-4-phenylbutyric acid, (S)-4-Amino-4-phenyl-butyric acid, (S)-4-Amino-4-phenylbutyric acid, g-Amino-benzenebutanoic acid