Products 1011-60-5
CAS 1011-60-5 is the registry number for 4-Amino-4-phenylbutanoic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-amino-4-phenylbutanoic acid (CAS 1011-60-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-amino-4-phenylbutanoic acid. InChIKey: QCHLDIVWWGHNQB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-amino-4-phenylbutanoic acid |
| InChIKey | QCHLDIVWWGHNQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
4-amino-4-phenylbutanoic acid, 4-Amino-4-phenyl-butyric acid, 4-amino-4-phenyl-butanoic acid, Benzenebutanoic acid, gamma-amino-, (R)-4-Amino-4-phenyl-butyric acid, gamma-Phenyl GABA, 4-Amino-4-phenylbutyric acid, (S)-4-Amino-4-phenyl-butyric acid, (S)-4-Amino-4-phenylbutyric acid, g-Amino-benzenebutanoic acid