4-Amino-5-bromonicotinic acid, 95%
cas: 52834-08-9 — see every product listed under this CAS number, including other names
4-Amino-5-bromonicotinic acid, 95% (CAS 52834-08-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F239740-100G |
| cas | 52834-08-9 |
| size | 100g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 11764.63 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 2162.00 Pln | |
| Chemat | 10g | 2867.60 Pln | |
| Chemat | 25g | 4211.60 Pln | |
| Chemat | 100g | 9160.40 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2143.01 Pln | |
| Fluorochem | 10g | 3361.33 Pln | |
| Fluorochem | 25g | 5506.41 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-amino-5-bromopyridine-3-carboxylic acid (CAS 52834-08-9) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 4-amino-5-bromopyridine-3-carboxylic acid. InChIKey: HMWXBQBQGAZHEU-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4-amino-5-bromopyridine-3-carboxylic acid |
| InChIKey | HMWXBQBQGAZHEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)N)C(=O)O |
Computed by PubChem (NCBI)