cas: 867130-83-4 — see every product listed under this CAS number, including other names
4-Amino-6-chloro-2-phenylpyridazin-3(2H)-one, 97%, 97% (CAS 867130-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE7W-100mg |
| cas | 867130-83-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 500mg | 2133.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-6-chloro-2-phenylpyridazin-3-one (CAS 867130-83-4) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 4-amino-6-chloro-2-phenylpyridazin-3-one. InChIKey: NTWANLJJEPZCRO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 4-amino-6-chloro-2-phenylpyridazin-3-one |
| InChIKey | NTWANLJJEPZCRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=CC(=N2)Cl)N |
Computed by PubChem (NCBI)