CAS 58905-19-4 is the registry number for 1-(4-Chlorophenyl)-2-(1h-1,2,4-triazol-1-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 58905-19-4) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: ZDGXDQYBMSMZLC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | ZDGXDQYBMSMZLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN2C=NC=N2)Cl |
Computed by PubChem (NCBI)