CAS 126542-93-6 is the registry number for 3-(4-Chlorophenyl)-6-methyl-1,2,4-triazin-5-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one (CAS 126542-93-6) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one. InChIKey: BHFWVAOPSUWYHS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one |
| InChIKey | BHFWVAOPSUWYHS-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(NC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)