CAS 1819358-30-9 is the registry number for 2-Chloro-4-(3-methyl-1h-1,2,4-triazol-1-yl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzaldehyde (CAS 1819358-30-9) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzaldehyde. InChIKey: GQCZHNPPMIUXET-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2-chloro-4-(3-methyl-1,2,4-triazol-1-yl)benzaldehyde |
| InChIKey | GQCZHNPPMIUXET-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C2=CC(=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)