4-Aminomethylphenylboronic acid hydrochloride, 98%, 98%
cas: 75705-21-4 — see every product listed under this CAS number, including other names
4-Aminomethylphenylboronic acid hydrochloride, 98%, 98% (CAS 75705-21-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116IU4-100mg |
| cas | 75705-21-4 |
| size | 100mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 462.80 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 100g | 2747.60 Pln | |
| Chemat | 50g | 1442.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(aminomethyl)phenyl]boronic acid;hydrochloride (CAS 75705-21-4) is a chemical compound with the molecular formula C7H11BClNO2 and a molecular weight of 187.43 g/mol. IUPAC name: [4-(aminomethyl)phenyl]boronic acid;hydrochloride. InChIKey: HUZNRXFJHYNUMV-UHFFFAOYSA-N.
| Molecular formula | C7H11BClNO2 |
|---|---|
| Molecular weight | 187.43 g/mol |
| IUPAC name | [4-(aminomethyl)phenyl]boronic acid;hydrochloride |
| InChIKey | HUZNRXFJHYNUMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(aminomethyl)benzeneboronic acid hydrochloride, 4-Aminomethylphenylboronic acid hydrochloride, 4-(aminomethyl)phenylboronic acid hydrochloride, [4-(aminomethyl)phenyl]boronic acid;hydrochloride, 4-aminomethylphenylboronic acid hcl, 4-aminomethylphenylboronic acid, hcl, 4-aminomethylphenylboronic acid, hydrochloride, (4-aminomethylphenyl)boronic acid hydrochloride, [4-(aminomethyl)phenyl]boronic acid hydrochloride, 4-Aminomethylbenzeneboronic acid hydrochloride