CAS 2230901-24-1 appears in our catalog under these names: (3-Amino-2-methylphenyl)boronic acid hydrochloride, 97%, (3–Amino–2–methylphenyl)boronic acid hydrochloride, (3-Amino-2-Methylphenyl)Boronic Acid Hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g.
(3-amino-2-methylphenyl)boronic acid;hydrochloride (CAS 2230901-24-1) is a chemical compound with the molecular formula C7H11BClNO2 and a molecular weight of 187.43 g/mol. IUPAC name: (3-amino-2-methylphenyl)boronic acid;hydrochloride. InChIKey: VSEPOTBSDLJYNX-UHFFFAOYSA-N.
| Molecular formula | C7H11BClNO2 |
|---|---|
| Molecular weight | 187.43 g/mol |
| IUPAC name | (3-amino-2-methylphenyl)boronic acid;hydrochloride |
| InChIKey | VSEPOTBSDLJYNX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)N)C)(O)O.Cl |
Computed by PubChem (NCBI)