Products 352525-95-2
CAS 352525-95-2 is the registry number for 3-Amino-4-methylphenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(3-amino-4-methylphenyl)boronic acid;hydrochloride (CAS 352525-95-2) is a chemical compound with the molecular formula C7H11BClNO2 and a molecular weight of 187.43 g/mol. IUPAC name: (3-amino-4-methylphenyl)boronic acid;hydrochloride. InChIKey: BKFDOPYYSBQWIK-UHFFFAOYSA-N.
| Molecular formula | C7H11BClNO2 |
|---|---|
| Molecular weight | 187.43 g/mol |
| IUPAC name | (3-amino-4-methylphenyl)boronic acid;hydrochloride |
| InChIKey | BKFDOPYYSBQWIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)N)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-Amino-4-methylphenyl)boronic acid--hydrogen chloride (1/1), 3-Amino-4-methylphenylboronic acid hydrochloride, (3-Amino-4-methylphenyl)boronic acid hydrochloride, 3-Amino-4-methylphenylboronic acid HCl, 3-Amino-4-methylphenylboronic acid, HCl, Boronic acid, (3-amino-4-methylphenyl)-, hydrochloride (9CI), (3-amino-4-methylphenyl)boronic acid;hydrochloride, (5-borono-2-methylphenyl)azanium;chloride, 3-Amino-4-methylbenzeneboronic acid hydrochloride, BKFDOPYYSBQWIK-UHFFFAOYSA-N