Products 2096330-83-3

CAS 2096330-83-3 is the registry number for 5-Amino-2-methylphenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

(5-amino-2-methylphenyl)boronic acid;hydrochloride (CAS 2096330-83-3) is a chemical compound with the molecular formula C7H11BClNO2 and a molecular weight of 187.43 g/mol. IUPAC name: (5-amino-2-methylphenyl)boronic acid;hydrochloride. InChIKey: WBCWXCMLZKKASL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11BClNO2
Molecular weight187.43 g/mol
IUPAC name(5-amino-2-methylphenyl)boronic acid;hydrochloride
InChIKeyWBCWXCMLZKKASL-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)N)C)(O)O.Cl

Computed by PubChem (NCBI)