Products 352525-94-1
CAS 352525-94-1 appears in our catalog under these names: 3-(Aminomethyl)benzeneboronic acid hydrochloride, 96% , (3-Aminomethylphenyl)boronic acidHydrochloride, (3-(Aminomethyl)Phenyl)Boronic Acid Hydrochloride, 97%, 97%, (3-(Aminomethyl)phenyl)boronic acid hydrochloride, 95%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2g, 5g, 10g, 25g, 100g, 100mg.
[3-(aminomethyl)phenyl]boronic acid;hydrochloride (CAS 352525-94-1) is a chemical compound with the molecular formula C7H11BClNO2 and a molecular weight of 187.43 g/mol. IUPAC name: [3-(aminomethyl)phenyl]boronic acid;hydrochloride. InChIKey: NPTBTFRGCBFYPZ-UHFFFAOYSA-N.
| Molecular formula | C7H11BClNO2 |
|---|---|
| Molecular weight | 187.43 g/mol |
| IUPAC name | [3-(aminomethyl)phenyl]boronic acid;hydrochloride |
| InChIKey | NPTBTFRGCBFYPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-(Aminomethyl)phenyl)boronic acid hydrochloride, 3-Aminomethylphenylboronic acid hydrochloride, 3-(Aminomethyl)phenylboronic acid hydrochloride, [3-(aminomethyl)phenyl]boronic acid;hydrochloride, [3-(aminomethyl)phenyl]boronic acid hydrochloride, 3-Aminomethylphenylboronic acid, HCl, (3-Aminomethylphenyl)boronic acid HCl, (3-aminomethyl)benzeneboronic acid hcl, (3-(aminomethyl)phenyl) boronic acid hydrochloride, (3-boronophenyl)methylazanium;chloride