cas: 274671-77-1 — see every product listed under this CAS number, including other names
4-BROMO-2,6-DICHLOROBENZYL ALCOHOL, 95% (CAS 274671-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390207-250MG |
| cas | 274671-77-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 534.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-bromo-2,6-dichlorophenyl)methanol (CAS 274671-77-1) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: (4-bromo-2,6-dichlorophenyl)methanol. InChIKey: DWHSTIUZSWZGGG-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (4-bromo-2,6-dichlorophenyl)methanol |
| InChIKey | DWHSTIUZSWZGGG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CO)Cl)Br |
Computed by PubChem (NCBI)