cas: 88404-25-5 — see every product listed under this CAS number, including other names
4-BROMOMETHYL-6,7-DIMETHOXYCOUMARIN, 98% (CAS 88404-25-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862683-25MG |
| cas | 88404-25-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 216.61 Pln | |
| Fluorochem | 50mg | 263.47 Pln | |
| Fluorochem | 100mg | 393.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(bromomethyl)-6,7-dimethoxychromen-2-one (CAS 88404-25-5) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: 4-(bromomethyl)-6,7-dimethoxychromen-2-one. InChIKey: JGODLBJJCNQFII-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 4-(bromomethyl)-6,7-dimethoxychromen-2-one |
| InChIKey | JGODLBJJCNQFII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=O)O2)CBr)OC |
Computed by PubChem (NCBI)