cas: 88404-25-5 — see every product listed under this CAS number, including other names
4-Bromomethyl-6,7-dimethoxycoumarin [for HPLC Labeling], >98.0%(HPLC) (CAS 88404-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A5570-100MG |
| cas | 88404-25-5 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 237.85 Pln | |
| TCI | 1g | 1172.13 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
4-(bromomethyl)-6,7-dimethoxychromen-2-one (CAS 88404-25-5) is a chemical compound with the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. IUPAC name: 4-(bromomethyl)-6,7-dimethoxychromen-2-one. InChIKey: JGODLBJJCNQFII-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO4 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 4-(bromomethyl)-6,7-dimethoxychromen-2-one |
| InChIKey | JGODLBJJCNQFII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=O)O2)CBr)OC |
Computed by PubChem (NCBI)