cas: 6317-57-3 — see every product listed under this CAS number, including other names
4-Benzylaniline hydrochloride, 98%+,RG, 98%+,RG (CAS 6317-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KSW-1g |
| cas | 6317-57-3 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 25g | 1110.80 Pln |
| purity | 98%+,RG |
|---|---|
| delivery time | 3 weeks |
4-benzylaniline;hydrochloride (CAS 6317-57-3) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 4-benzylaniline;hydrochloride. InChIKey: GQGXIDBMRPMPCD-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 4-benzylaniline;hydrochloride |
| InChIKey | GQGXIDBMRPMPCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)