cas: 773873-94-2 — see every product listed under this CAS number, including other names
4-Benzyloxy-3,5-dimethyl-benzoic acid methyl ester (CAS 773873-94-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633139-5G |
| cas | 773873-94-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 13602.52 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3,5-dimethyl-4-phenylmethoxybenzoate (CAS 773873-94-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: methyl 3,5-dimethyl-4-phenylmethoxybenzoate. InChIKey: AYTNLJWOSHLUPV-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | methyl 3,5-dimethyl-4-phenylmethoxybenzoate |
| InChIKey | AYTNLJWOSHLUPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC2=CC=CC=C2)C)C(=O)OC |
Computed by PubChem (NCBI)