cas: 1486-53-9 — see every product listed under this CAS number, including other names
4-Benzyloxy-3-methoxybenzoicacid 98% (CAS 1486-53-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112659-5g |
| cas | 1486-53-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112659 |
3-methoxy-4-phenylmethoxybenzoic acid (CAS 1486-53-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-methoxy-4-phenylmethoxybenzoic acid. InChIKey: JGMBQAGNZLBZCE-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-methoxy-4-phenylmethoxybenzoic acid |
| InChIKey | JGMBQAGNZLBZCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)