cas: 56441-69-1 — see every product listed under this CAS number, including other names
4-Benzyloxyphenylacetic acid ethyl ester (CAS 56441-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009704-250MG |
| cas | 56441-69-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1138.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
Ethyl 2-(4-phenylmethoxyphenyl)acetate (CAS 56441-69-1) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: ethyl 2-(4-phenylmethoxyphenyl)acetate. InChIKey: MMKJGLKGTNSPFJ-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | ethyl 2-(4-phenylmethoxyphenyl)acetate |
| InChIKey | MMKJGLKGTNSPFJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)