cas: 14002-51-8 — see every product listed under this CAS number, including other names
4-Biphenylcarbonyl chloride, 98% (CAS 14002-51-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 1g, 25g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 171250100 |
| cas | 14002-51-8 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 224.95 Pln | |
| Thermo Scientific (Acros) | 50g | 668.17 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 25g | 253.05 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-phenylbenzoyl chloride (CAS 14002-51-8) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 4-phenylbenzoyl chloride. InChIKey: JPVUWCPKMYXOKW-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-phenylbenzoyl chloride |
| InChIKey | JPVUWCPKMYXOKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)