CAS 22360-00-5 is the registry number for 6–Bromo–5H–benzo(7)annulen–5–one. Offered by: GLPBio. Available pack sizes: 25mg.
6-bromobenzo[7]annulen-5-one (CAS 22360-00-5) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 6-bromobenzo[7]annulen-5-one. InChIKey: HOQQWBNNCXRXQW-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 6-bromobenzo[7]annulen-5-one |
| InChIKey | HOQQWBNNCXRXQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C(C2=O)Br |
Computed by PubChem (NCBI)