4-Bromo-2,5-dimethylbenzoic acid, 98%
cas: 276677-03-3 — see every product listed under this CAS number, including other names
4-Bromo-2,5-dimethylbenzoic acid, 98% (CAS 276677-03-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 500mg, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F069700-250MG |
| cas | 276677-03-3 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 500mg | 216.61 Pln | |
| Fluorochem | 5g | 716.43 Pln | |
| Fluorochem | 10g | 966.34 Pln | |
| Fluorochem | 25g | 1700.46 Pln | |
| Fluorochem | 100g | 4944.11 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 506.00 Pln | |
| Chemat | 25g | 1014.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-bromo-2,5-dimethylbenzoic acid (CAS 276677-03-3) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 4-bromo-2,5-dimethylbenzoic acid. InChIKey: PYZYBJKFYYDWPH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylbenzoic acid |
| InChIKey | PYZYBJKFYYDWPH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)O |
Computed by PubChem (NCBI)