CAS 276677-03-3 appears in our catalog under these names: 4-Bromo-2,5-dimethylbenzoic acid, 95%, 4-Bromo-2,5-dimethylbenzoic acid, 4-Bromo-2,5-dimethylbenzoic acid 95+%, 4-Bromo-2,5-dimethylbenzoic acid, 98%, 98%, 4-Bromo-2,5-dimethylbenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 500mg, 100g.
4-bromo-2,5-dimethylbenzoic acid (CAS 276677-03-3) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 4-bromo-2,5-dimethylbenzoic acid. InChIKey: PYZYBJKFYYDWPH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylbenzoic acid |
| InChIKey | PYZYBJKFYYDWPH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)O |
Computed by PubChem (NCBI)