cas: 56037-74-2 — see every product listed under this CAS number, including other names
4-Bromo-2,6-dichloro-3-methylphenol (CAS 56037-74-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631806-1G |
| cas | 56037-74-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6495.65 Pln | |
| Fluorochem | 5g | 19366.12 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2,6-dichloro-3-methylphenol (CAS 56037-74-2) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: 4-bromo-2,6-dichloro-3-methylphenol. InChIKey: SQCAINOXUYGYKI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | 4-bromo-2,6-dichloro-3-methylphenol |
| InChIKey | SQCAINOXUYGYKI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)O)Cl)Br |
Computed by PubChem (NCBI)