Products 663601-56-7
CAS 663601-56-7 is the registry number for 2-Bromo-3,4-difluoro-1-(trifluoromethyl)-benzene. Offered by: TRC. Available pack sizes: 250mg.
3-bromo-1,2-difluoro-4-(trifluoromethyl)benzene (CAS 663601-56-7) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 3-bromo-1,2-difluoro-4-(trifluoromethyl)benzene. InChIKey: WCVYOXFOMBBLSU-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 3-bromo-1,2-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | WCVYOXFOMBBLSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Br)F)F |
Computed by PubChem (NCBI)