Products 1805523-62-9
CAS 1805523-62-9 is the registry number for 1-Bromo-3,5-difluoro-2-(trifluoromethyl)benzene. Offered by: TRC. Available pack sizes: 100mg.
1-bromo-3,5-difluoro-2-(trifluoromethyl)benzene (CAS 1805523-62-9) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-3,5-difluoro-2-(trifluoromethyl)benzene. InChIKey: TYOPJVOERDAZCC-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-3,5-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | TYOPJVOERDAZCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)Br)F |
Computed by PubChem (NCBI)