cas: 958650-71-0 — see every product listed under this CAS number, including other names
4-Bromo-2,6-dimethylbiphenyl, ≥95%, ≥95% (CAS 958650-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q9B-1g |
| cas | 958650-71-0 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2032.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,3-dimethyl-2-phenylbenzene (CAS 958650-71-0) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 5-bromo-1,3-dimethyl-2-phenylbenzene. InChIKey: MBZDJJXYAKGOOB-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 5-bromo-1,3-dimethyl-2-phenylbenzene |
| InChIKey | MBZDJJXYAKGOOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=CC=C2)C)Br |
Computed by PubChem (NCBI)