cas: 628326-12-5 — see every product listed under this CAS number, including other names
4-Bromo-2-(4-methylpiperazino)benzaldehyde, >97%, >97% (CAS 628326-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KV0-100mg |
| cas | 628326-12-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 5g | 1830.80 Pln | |
| Chemat | 250mg | 434.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde (CAS 628326-12-5) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: NIOICRGSDAAJOW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | NIOICRGSDAAJOW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)Br)C=O |
Computed by PubChem (NCBI)