CAS 771580-37-1 appears in our catalog under these names: (4-Bromo-2,3,5,6-tetrafluorophenyl)methanamine, 95%, (4-Bromo-2,3,5,6-tetrafluorophenyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4-bromo-2,3,5,6-tetrafluorophenyl)methanamine (CAS 771580-37-1) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: (4-bromo-2,3,5,6-tetrafluorophenyl)methanamine. InChIKey: RHATXBXVRLKIMV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | (4-bromo-2,3,5,6-tetrafluorophenyl)methanamine |
| InChIKey | RHATXBXVRLKIMV-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)Br)F)F)N |
Computed by PubChem (NCBI)