CAS 1421599-51-0 is the registry number for 3-Bromo-4-fluoro-2-(trifluoromethyl)aniline, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-bromo-4-fluoro-2-(trifluoromethyl)aniline (CAS 1421599-51-0) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 3-bromo-4-fluoro-2-(trifluoromethyl)aniline. InChIKey: GMRXYTAORZTSCR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 3-bromo-4-fluoro-2-(trifluoromethyl)aniline |
| InChIKey | GMRXYTAORZTSCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(F)(F)F)Br)F |
Computed by PubChem (NCBI)