cas: 1451393-15-9 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5(trifluoromethyl)phenylboronic acid, 97%, 97% (CAS 1451393-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AWV3-100mg |
| cas | 1451393-15-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1826.00 Pln | |
| Chemat | 10g | 3486.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 1451393-15-9) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: PKNMTVAEKUCNKC-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PKNMTVAEKUCNKC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)