CAS 1451392-89-4 appears in our catalog under these names: 3-Bromo-2-fluoro-6-(trifluoromethyl)phenylboronic acid, 90%, 3-Bromo-2-fluoro-6-(trifluoromethyl)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
[3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid (CAS 1451392-89-4) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: HUONDTNQVHGQDN-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | HUONDTNQVHGQDN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)