Products 1451392-89-4

CAS 1451392-89-4 is the registry number for 3-Bromo-2-fluoro-6-(trifluoromethyl)phenylboronic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.

Structural formula: {0} (CAS {1})

[3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid (CAS 1451392-89-4) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: HUONDTNQVHGQDN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BBrF4O2
Molecular weight286.82 g/mol
IUPAC name[3-bromo-2-fluoro-6-(trifluoromethyl)phenyl]boronic acid
InChIKeyHUONDTNQVHGQDN-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)Br)C(F)(F)F)(O)O

Computed by PubChem (NCBI)