Products 2096338-38-2
CAS 2096338-38-2 appears in our catalog under these names: 3-Bromo-2-fluoro-5-trifluoromethylphenylboronic acid, 3-Bromo-2-fluoro-5-trifluoromethylphenylboronic acid, 98%, (3-Bromo-2-fluoro-5-(trifluoromethyl)phenyl)boronic acid, 97%, 3-Bromo-2-fluoro-5-trifluoromethylphenylboronic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 25g.
[3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 2096338-38-2) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: VWFBSZFKKNFRJJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | VWFBSZFKKNFRJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)