CAS 2096341-70-5 is the registry number for 5-Bromo-2-fluoro-3-trifluoromethylphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 100g.
[5-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2096341-70-5) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [5-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: WRIJOUMGMHQBFI-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [5-bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WRIJOUMGMHQBFI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)