CAS 1451393-15-9 appears in our catalog under these names: 4-Bromo-2-fluoro-5-(trifluoromethyl)phenylboronic acid, 96%, 4-Bromo-2-fluoro-5(trifluoromethyl)phenylboronic acid, 97%, 97%, (4-Bromo-2-fluoro-5-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid (CAS 1451393-15-9) is a chemical compound with the molecular formula C7H4BBrF4O2 and a molecular weight of 286.82 g/mol. IUPAC name: [4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: PKNMTVAEKUCNKC-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF4O2 |
|---|---|
| Molecular weight | 286.82 g/mol |
| IUPAC name | [4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PKNMTVAEKUCNKC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)