CAS 6127-11-3 appears in our catalog under these names: 4-Bromo-2-nitrophenylacetic Acid, >97.0%(T), Benzeneacetic acid, 4-bromo-2-nitro-, 97%, 97%. Offered by: TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
2-(4-bromo-2-nitrophenyl)acetic acid (CAS 6127-11-3) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 2-(4-bromo-2-nitrophenyl)acetic acid. InChIKey: LBZPHZBNFDOCCR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 2-(4-bromo-2-nitrophenyl)acetic acid |
| InChIKey | LBZPHZBNFDOCCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)