Products 59820-92-7
CAS 59820-92-7 appears in our catalog under these names: 6-Bromo-7-nitrobenzo(1,4)dioxan, 95%, 6-Bromo-7-nitro-2,3-dihydrobenzo(b)(1,4)dioxine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
6-bromo-7-nitro-2,3-dihydro-1,4-benzodioxine (CAS 59820-92-7) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 6-bromo-7-nitro-2,3-dihydro-1,4-benzodioxine. InChIKey: PBFAMONJVJBDQV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 6-bromo-7-nitro-2,3-dihydro-1,4-benzodioxine |
| InChIKey | PBFAMONJVJBDQV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)