cas: 756873-19-5 — see every product listed under this CAS number, including other names
4-Bromo-3,5-dimethyl-1,1'-biphenyl, 95%, 95% (CAS 756873-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116VM5-100mg |
| cas | 756873-19-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1307.60 Pln | |
| Chemat | 250mg | 2373.20 Pln | |
| Chemat | 1g | 4682.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1,3-dimethyl-5-phenylbenzene (CAS 756873-19-5) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-phenylbenzene. InChIKey: OBGLZCFMKVODIR-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-phenylbenzene |
| InChIKey | OBGLZCFMKVODIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)