cas: 870196-03-5 — see every product listed under this CAS number, including other names
4-Bromo-3-(methoxycarbonyl)phenylboronic acid (CAS 870196-03-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627229-1G |
| cas | 870196-03-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2236.73 Pln | |
| Fluorochem | 5g | 6594.57 Pln |
| delivery time | 3-4 weeks |
|---|
(4-bromo-3-methoxycarbonylphenyl)boronic acid (CAS 870196-03-5) is a chemical compound with the molecular formula C8H8BBrO4 and a molecular weight of 258.86 g/mol. IUPAC name: (4-bromo-3-methoxycarbonylphenyl)boronic acid. InChIKey: OUIKETNLSCVSSN-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO4 |
|---|---|
| Molecular weight | 258.86 g/mol |
| IUPAC name | (4-bromo-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | OUIKETNLSCVSSN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)C(=O)OC)(O)O |
Computed by PubChem (NCBI)