cas: 741698-94-2 — see every product listed under this CAS number, including other names
4-Bromo-3-isopropylbenzoic acid 95% (CAS 741698-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A647819-100g |
| cas | 741698-94-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 18170.38 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 25g | 5727.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A647819 |
4-bromo-3-propan-2-ylbenzoic acid (CAS 741698-94-2) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 4-bromo-3-propan-2-ylbenzoic acid. InChIKey: AVLGNLUCRVKPGU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 4-bromo-3-propan-2-ylbenzoic acid |
| InChIKey | AVLGNLUCRVKPGU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)