cas: 591775-13-2 — see every product listed under this CAS number, including other names
4-Bromo-3-methyl-benzoic acid benzyl ester, ≥99.8%, ≥99.8% (CAS 591775-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SCK1-1g |
| cas | 591775-13-2 |
| size | 1g |
| availability | 53g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2229.20 Pln |
| purity | ≥99.8% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-bromo-3-methylbenzoate (CAS 591775-13-2) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: benzyl 4-bromo-3-methylbenzoate. InChIKey: SGLOQAVILGCIRP-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO2 |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | benzyl 4-bromo-3-methylbenzoate |
| InChIKey | SGLOQAVILGCIRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)