Products 1311291-88-9

CAS 1311291-88-9 is the registry number for Methyl 3'-(bromomethyl)-[1,1'-biphenyl]-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-[3-(bromomethyl)phenyl]benzoate (CAS 1311291-88-9) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: methyl 4-[3-(bromomethyl)phenyl]benzoate. InChIKey: JURYFRQHXNQEHV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13BrO2
Molecular weight305.17 g/mol
IUPAC namemethyl 4-[3-(bromomethyl)phenyl]benzoate
InChIKeyJURYFRQHXNQEHV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C2=CC=CC(=C2)CBr

Computed by PubChem (NCBI)