CAS 1411993-02-6 is the registry number for 4'-Bromo-3'-methyl-biphenyl-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(4-bromo-3-methylphenyl)benzoate (CAS 1411993-02-6) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: methyl 4-(4-bromo-3-methylphenyl)benzoate. InChIKey: SIEFTTFJGLAEDT-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO2 |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | methyl 4-(4-bromo-3-methylphenyl)benzoate |
| InChIKey | SIEFTTFJGLAEDT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)