CAS 591775-13-2 appears in our catalog under these names: 4-Bromo-3-methylbenzoic acid benzyl ester, 95%, 4-Bromo-3-methyl-benzoic acid benzyl ester, ≥99.8%, ≥99.8%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Benzyl 4-bromo-3-methylbenzoate (CAS 591775-13-2) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: benzyl 4-bromo-3-methylbenzoate. InChIKey: SGLOQAVILGCIRP-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO2 |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | benzyl 4-bromo-3-methylbenzoate |
| InChIKey | SGLOQAVILGCIRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)