Products 291289-66-2

CAS 291289-66-2 is the registry number for Benzyl 2-bromo-3-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 2-bromo-3-methylbenzoate (CAS 291289-66-2) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: benzyl 2-bromo-3-methylbenzoate. InChIKey: WCASAPGYUIEPRO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13BrO2
Molecular weight305.17 g/mol
IUPAC namebenzyl 2-bromo-3-methylbenzoate
InChIKeyWCASAPGYUIEPRO-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C(=O)OCC2=CC=CC=C2)Br

Computed by PubChem (NCBI)