CAS 291289-66-2 is the registry number for Benzyl 2-bromo-3-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Benzyl 2-bromo-3-methylbenzoate (CAS 291289-66-2) is a chemical compound with the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. IUPAC name: benzyl 2-bromo-3-methylbenzoate. InChIKey: WCASAPGYUIEPRO-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO2 |
|---|---|
| Molecular weight | 305.17 g/mol |
| IUPAC name | benzyl 2-bromo-3-methylbenzoate |
| InChIKey | WCASAPGYUIEPRO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)